C27H35NO2 — CID 12015506
(1R,2S,5R)-2-[2-[(1R,8S,11R)-11-(2-methoxyphenyl)-9-azatricyclo[6.2.1.02,7]undeca-2,4,6-trien-9-yl]propan-2-yl]-5-methylcyclohexan-1-ol (PubChem CID 12015506) has the molecular formula C27H35NO2 and a molecular weight of 405.58 g/mol. Its IUPAC name is (1R,2S,5R)-2-[2-[(1R,8S,11R)-11-(2-methoxyphenyl)-9-azatricyclo[6.2.1.02,7]undeca-2,4,6-trien-9-yl]propan-2-yl]-5-methylcyclohexan-1-ol.
| Compound Name | (1R,2S,5R)-2-[2-[(1R,8S,11R)-11-(2-methoxyphenyl)-9-azatricyclo[6.2.1.02,7]undeca-2,4,6-trien-9-yl]propan-2-yl]-5-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 12015506 |
| Molecular Formula | C27H35NO2 |
| Molecular Weight | 405.58 g/mol |
| Exact Mass | 405.27 |
| IUPAC Name | (1R,2S,5R)-2-[2-[(1R,8S,11R)-11-(2-methoxyphenyl)-9-azatricyclo[6.2.1.02,7]undeca-2,4,6-trien-9-yl]propan-2-yl]-5-methylcyclohexan-1-ol |
| SMILES | COc1ccccc1[C@@H]1[C@H]2c3ccccc3[C@@H]1CN2C(C)(C)[C@@H]1CC[C@@H](C)C[C@H]1O |
| InChI | InChI=1S/C27H35NO2/c1-17-13-14-22(23(29)15-17)27(2,3)28-16-21-18-9-5-6-10-19(18)26(28)25(21)20-11-7-8-12-24(20)30-4/h5-12,17,21-23,25-26,29H,13-16H2,1-4H3/t17-,21+,22-,23-,25+,26-/m1/s1 |
| InChIKey | XBXIMLZOEZFLNN-DIJNPRPXSA-N |
| XLogP | 5.51 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.58 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |