C23H36N2O — CID 102272061
(1R,2S,5R)-2-[2-[(3R,3aR,6aR)-1-methyl-3-phenyl-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-b]pyrrol-5-yl]propan-2-yl]-5-methylcyclohexan-1-ol (PubChem CID 102272061) has the molecular formula C23H36N2O and a molecular weight of 356.55 g/mol. Its IUPAC name is (1R,2S,5R)-2-[2-[(3R,3aR,6aR)-1-methyl-3-phenyl-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-b]pyrrol-5-yl]propan-2-yl]-5-methylcyclohexan-1-ol.
| Compound Name | (1R,2S,5R)-2-[2-[(3R,3aR,6aR)-1-methyl-3-phenyl-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-b]pyrrol-5-yl]propan-2-yl]-5-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 102272061 |
| Molecular Formula | C23H36N2O |
| Molecular Weight | 356.55 g/mol |
| Exact Mass | 356.28 |
| IUPAC Name | (1R,2S,5R)-2-[2-[(3R,3aR,6aR)-1-methyl-3-phenyl-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-b]pyrrol-5-yl]propan-2-yl]-5-methylcyclohexan-1-ol |
| SMILES | C[C@@H]1CC[C@@H](C(C)(C)N2C[C@H]3[C@H](c4ccccc4)CN(C)[C@H]3C2)[C@H](O)C1 |
| InChI | InChI=1S/C23H36N2O/c1-16-10-11-20(22(26)12-16)23(2,3)25-14-19-18(13-24(4)21(19)15-25)17-8-6-5-7-9-17/h5-9,16,18-22,26H,10-15H2,1-4H3/t16-,18+,19+,20-,21+,22-/m1/s1 |
| InChIKey | UEFPOZQIYYSLQB-GOVIEYFISA-N |
| XLogP | 3.59 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.55 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |