C18H17F4NO5 — CID 1201996
4-[[(1R,6S)-6-(2,2,3,3-tetrafluoropropoxycarbonyl)cyclohex-3-ene-1-carbonyl]amino]benzoic acid (PubChem CID 1201996) has the molecular formula C18H17F4NO5 and a molecular weight of 403.33 g/mol. Its IUPAC name is 4-[[(1R,6S)-6-(2,2,3,3-tetrafluoropropoxycarbonyl)cyclohex-3-ene-1-carbonyl]amino]benzoic acid.
| Compound Name | 4-[[(1R,6S)-6-(2,2,3,3-tetrafluoropropoxycarbonyl)cyclohex-3-ene-1-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 1201996 |
| Molecular Formula | C18H17F4NO5 |
| Molecular Weight | 403.33 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | 4-[[(1R,6S)-6-(2,2,3,3-tetrafluoropropoxycarbonyl)cyclohex-3-ene-1-carbonyl]amino]benzoic acid |
| SMILES | O=C(O)c1ccc(NC(=O)[C@@H]2CC=CC[C@@H]2C(=O)OCC(F)(F)C(F)F)cc1 |
| InChI | InChI=1S/C18H17F4NO5/c19-17(20)18(21,22)9-28-16(27)13-4-2-1-3-12(13)14(24)23-11-7-5-10(6-8-11)15(25)26/h1-2,5-8,12-13,17H,3-4,9H2,(H,23,24)(H,25,26)/t12-,13+/m1/s1 |
| InChIKey | WXCHDETYVQEOEU-OLZOCXBDSA-N |
| XLogP | 3.35 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.33 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|