C14H14F4N2O3S — CID 1253003
2,2,3,3-tetrafluoropropyl (1S,6R)-6-(1,3-thiazol-2-ylcarbamoyl)cyclohex-3-ene-1-carboxylate (PubChem CID 1253003) has the molecular formula C14H14F4N2O3S and a molecular weight of 366.34 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoropropyl (1S,6R)-6-(1,3-thiazol-2-ylcarbamoyl)cyclohex-3-ene-1-carboxylate.
| Compound Name | 2,2,3,3-tetrafluoropropyl (1S,6R)-6-(1,3-thiazol-2-ylcarbamoyl)cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 1253003 |
| Molecular Formula | C14H14F4N2O3S |
| Molecular Weight | 366.34 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | 2,2,3,3-tetrafluoropropyl (1S,6R)-6-(1,3-thiazol-2-ylcarbamoyl)cyclohex-3-ene-1-carboxylate |
| SMILES | O=C(OCC(F)(F)C(F)F)[C@H]1CC=CC[C@H]1C(=O)Nc1nccs1 |
| InChI | InChI=1S/C14H14F4N2O3S/c15-12(16)14(17,18)7-23-11(22)9-4-2-1-3-8(9)10(21)20-13-19-5-6-24-13/h1-2,5-6,8-9,12H,3-4,7H2,(H,19,20,21)/t8-,9+/m1/s1 |
| InChIKey | JEHHMJWQQGHDMM-BDAKNGLRSA-N |
| XLogP | 3.11 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.34 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|