C32H30 — CID 12022913
1-[(E)-dec-3-en-1,5-diynyl]-4-[4-[(E)-dec-3-en-1,5-diynyl]phenyl]benzene (PubChem CID 12022913) has the molecular formula C32H30 and a molecular weight of 414.59 g/mol. Its IUPAC name is 1-[(E)-dec-3-en-1,5-diynyl]-4-[4-[(E)-dec-3-en-1,5-diynyl]phenyl]benzene.
| Compound Name | 1-[(E)-dec-3-en-1,5-diynyl]-4-[4-[(E)-dec-3-en-1,5-diynyl]phenyl]benzene |
|---|---|
| PubChem CID | 12022913 |
| Molecular Formula | C32H30 |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | 1-[(E)-dec-3-en-1,5-diynyl]-4-[4-[(E)-dec-3-en-1,5-diynyl]phenyl]benzene |
| SMILES | CCCCC#C/C=C/C#Cc1ccc(-c2ccc(C#C/C=C/C#CCCCC)cc2)cc1 |
| InChI | InChI=1S/C32H30/c1-3-5-7-9-11-13-15-17-19-29-21-25-31(26-22-29)32-27-23-30(24-28-32)20-18-16-14-12-10-8-6-4-2/h13-16,21-28H,3-8H2,1-2H3/b15-13+,16-14+ |
| InChIKey | QFXBPVCRRYOBIF-WXUKJITCSA-N |
| XLogP | 7.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|