C17H18S — CID 71419140
1-dec-3-en-1,5-diynyl-2-methylsulfanylbenzene (PubChem CID 71419140) has the molecular formula C17H18S and a molecular weight of 254.40 g/mol. Its IUPAC name is 1-dec-3-en-1,5-diynyl-2-methylsulfanylbenzene.
| Compound Name | 1-dec-3-en-1,5-diynyl-2-methylsulfanylbenzene |
|---|---|
| PubChem CID | 71419140 |
| Molecular Formula | C17H18S |
| Molecular Weight | 254.40 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 1-dec-3-en-1,5-diynyl-2-methylsulfanylbenzene |
| SMILES | CCCCC#CC=CC#Cc1ccccc1SC |
| InChI | InChI=1S/C17H18S/c1-3-4-5-6-7-8-9-10-13-16-14-11-12-15-17(16)18-2/h8-9,11-12,14-15H,3-5H2,1-2H3 |
| InChIKey | BFJBZDXQUBCIGL-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.40 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|