C16H16O — CID 71419164
2-dec-3-en-1,5-diynylphenol (PubChem CID 71419164) has the molecular formula C16H16O and a molecular weight of 224.30 g/mol. Its IUPAC name is 2-dec-3-en-1,5-diynylphenol.
| Compound Name | 2-dec-3-en-1,5-diynylphenol |
|---|---|
| PubChem CID | 71419164 |
| Molecular Formula | C16H16O |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 2-dec-3-en-1,5-diynylphenol |
| SMILES | CCCCC#CC=CC#Cc1ccccc1O |
| InChI | InChI=1S/C16H16O/c1-2-3-4-5-6-7-8-9-12-15-13-10-11-14-16(15)17/h7-8,10-11,13-14,17H,2-4H2,1H3 |
| InChIKey | XAHNEMSFSCQAPB-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|