C11H18O — CID 12023482
(6R)-6-cyclohexyl-3,6-dihydro-2H-pyran (PubChem CID 12023482) has the molecular formula C11H18O and a molecular weight of 166.26 g/mol. Its IUPAC name is (6R)-6-cyclohexyl-3,6-dihydro-2H-pyran.
| Compound Name | (6R)-6-cyclohexyl-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 12023482 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | (6R)-6-cyclohexyl-3,6-dihydro-2H-pyran |
| SMILES | C1=C[C@@H](C2CCCCC2)OCC1 |
| InChI | InChI=1S/C11H18O/c1-2-6-10(7-3-1)11-8-4-5-9-12-11/h4,8,10-11H,1-3,5-7,9H2/t11-/m0/s1 |
| InChIKey | PMZBNAUDEPEPIN-NSHDSACASA-N |
| XLogP | 2.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|