C18H18F3NO — CID 12030449
(2S)-1-[(1R)-2-methoxy-1-phenylethyl]-2-[4-(trifluoromethyl)phenyl]aziridine (PubChem CID 12030449) has the molecular formula C18H18F3NO and a molecular weight of 321.34 g/mol. Its IUPAC name is (2S)-1-[(1R)-2-methoxy-1-phenylethyl]-2-[4-(trifluoromethyl)phenyl]aziridine.
| Compound Name | (2S)-1-[(1R)-2-methoxy-1-phenylethyl]-2-[4-(trifluoromethyl)phenyl]aziridine |
|---|---|
| PubChem CID | 12030449 |
| Molecular Formula | C18H18F3NO |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | (2S)-1-[(1R)-2-methoxy-1-phenylethyl]-2-[4-(trifluoromethyl)phenyl]aziridine |
| SMILES | COC[C@@H](c1ccccc1)N1C[C@@H]1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H18F3NO/c1-23-12-17(13-5-3-2-4-6-13)22-11-16(22)14-7-9-15(10-8-14)18(19,20)21/h2-10,16-17H,11-12H2,1H3/t16-,17+,22?/m1/s1 |
| InChIKey | LKUDHRBHYDZVNN-KDPSSXBDSA-N |
| XLogP | 4.45 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|