C10H19ClO5P2 — CID 12030675
4-chloro-3-dimethoxyphosphoryl-1-ethoxy-5-methyl-3,6-dihydro-2H-1λ5-phosphinine 1-oxide (PubChem CID 12030675) has the molecular formula C10H19ClO5P2 and a molecular weight of 316.66 g/mol. Its IUPAC name is 4-chloro-3-dimethoxyphosphoryl-1-ethoxy-5-methyl-3,6-dihydro-2H-1λ5-phosphinine 1-oxide.
| Compound Name | 4-chloro-3-dimethoxyphosphoryl-1-ethoxy-5-methyl-3,6-dihydro-2H-1λ5-phosphinine 1-oxide |
|---|---|
| PubChem CID | 12030675 |
| Molecular Formula | C10H19ClO5P2 |
| Molecular Weight | 316.66 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | 4-chloro-3-dimethoxyphosphoryl-1-ethoxy-5-methyl-3,6-dihydro-2H-1λ5-phosphinine 1-oxide |
| SMILES | CCOP1(=O)CC(C)=C(Cl)C(P(=O)(OC)OC)C1 |
| InChI | InChI=1S/C10H19ClO5P2/c1-5-16-17(12)6-8(2)10(11)9(7-17)18(13,14-3)15-4/h9H,5-7H2,1-4H3 |
| InChIKey | BMIREFYMEQSYFB-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.66 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|