C8H14ClO2P — CID 15360139
4-chloro-1-ethoxy-5-methyl-3,6-dihydro-2H-1λ5-phosphinine 1-oxide (PubChem CID 15360139) has the molecular formula C8H14ClO2P and a molecular weight of 208.62 g/mol. Its IUPAC name is 4-chloro-1-ethoxy-5-methyl-3,6-dihydro-2H-1λ5-phosphinine 1-oxide.
| Compound Name | 4-chloro-1-ethoxy-5-methyl-3,6-dihydro-2H-1λ5-phosphinine 1-oxide |
|---|---|
| PubChem CID | 15360139 |
| Molecular Formula | C8H14ClO2P |
| Molecular Weight | 208.62 g/mol |
| Exact Mass | 208.04 |
| IUPAC Name | 4-chloro-1-ethoxy-5-methyl-3,6-dihydro-2H-1λ5-phosphinine 1-oxide |
| SMILES | CCOP1(=O)CCC(Cl)=C(C)C1 |
| InChI | InChI=1S/C8H14ClO2P/c1-3-11-12(10)5-4-8(9)7(2)6-12/h3-6H2,1-2H3 |
| InChIKey | YZKXFKPBMQXKEK-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.62 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|