C6H9NO3 — CID 12037079
2-methyl-1-oxido-3,4-dihydropyrrol-1-ium-2-carboxylic acid (PubChem CID 12037079) has the molecular formula C6H9NO3 and a molecular weight of 143.14 g/mol. Its IUPAC name is 2-methyl-1-oxido-3,4-dihydropyrrol-1-ium-2-carboxylic acid.
| Compound Name | 2-methyl-1-oxido-3,4-dihydropyrrol-1-ium-2-carboxylic acid |
|---|---|
| PubChem CID | 12037079 |
| Molecular Formula | C6H9NO3 |
| Molecular Weight | 143.14 g/mol |
| Exact Mass | 143.06 |
| IUPAC Name | 2-methyl-1-oxido-3,4-dihydropyrrol-1-ium-2-carboxylic acid |
| SMILES | CC1(C(=O)O)CCC=[N+]1[O-] |
| InChI | InChI=1S/C6H9NO3/c1-6(5(8)9)3-2-4-7(6)10/h4H,2-3H2,1H3,(H,8,9) |
| InChIKey | QHSWDTIJMXEPJS-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.14 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|