About 5-methyl-1,4,6,9-tetrazatricyclo[7.3.1.05,13]tridecane
5-methyl-1,4,6,9-tetrazatricyclo[7.3.1.05,13]tridecane (PubChem CID 12038162) has the molecular formula C10H20N4
and a molecular weight of 196.30 g/mol. Its IUPAC name is 5-methyl-1,4,6,9-tetrazatricyclo[7.3.1.05,13]tridecane.
Analyze 5-methyl-1,4,6,9-tetrazatricyclo[7.3.1.05,13]tridecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-1,4,6,9-tetrazatricyclo[7.3.1.05,13]tridecane?
The IUPAC name of 5-methyl-1,4,6,9-tetrazatricyclo[7.3.1.05,13]tridecane (CID 12038162) is 5-methyl-1,4,6,9-tetrazatricyclo[7.3.1.05,13]tridecane.
What is the SMILES notation for 5-methyl-1,4,6,9-tetrazatricyclo[7.3.1.05,13]tridecane?
The canonical SMILES for 5-methyl-1,4,6,9-tetrazatricyclo[7.3.1.05,13]tridecane is CC12NCCN3CCCN(CCN1)C32.
What is the InChIKey of 5-methyl-1,4,6,9-tetrazatricyclo[7.3.1.05,13]tridecane?
The InChIKey is PTCOOQLPLDIDDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N4/c1-10-9-13(7-3-11-10)5-2-6-14(9)8-4-12-10/h9,11-12H,2-8H2,1H3.
What are the key properties of 5-methyl-1,4,6,9-tetrazatricyclo[7.3.1.05,13]tridecane?
5-methyl-1,4,6,9-tetrazatricyclo[7.3.1.05,13]tridecane has a molecular weight of 196.30 g/mol, XLogP of -0.76, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-1,4,6,9-tetrazatricyclo[7.3.1.05,13]tridecane is sourced from PubChem (CID 12038162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).