C34H44N2O2 — CID 12043666
[(1S,2S,7S,10R,11S,14S,15S,25S)-10,14,16-trimethyl-17,18-diazahexacyclo[12.12.0.02,11.05,10.015,25.019,24]hexacosa-4,16,18-trien-7-yl] benzoate (PubChem CID 12043666) has the molecular formula C34H44N2O2 and a molecular weight of 512.74 g/mol. Its IUPAC name is [(1S,2S,7S,10R,11S,14S,15S,25S)-10,14,16-trimethyl-17,18-diazahexacyclo[12.12.0.02,11.05,10.015,25.019,24]hexacosa-4,16,18-trien-7-yl] benzoate.
| Compound Name | [(1S,2S,7S,10R,11S,14S,15S,25S)-10,14,16-trimethyl-17,18-diazahexacyclo[12.12.0.02,11.05,10.015,25.019,24]hexacosa-4,16,18-trien-7-yl] benzoate |
|---|---|
| PubChem CID | 12043666 |
| Molecular Formula | C34H44N2O2 |
| Molecular Weight | 512.74 g/mol |
| Exact Mass | 512.34 |
| IUPAC Name | [(1S,2S,7S,10R,11S,14S,15S,25S)-10,14,16-trimethyl-17,18-diazahexacyclo[12.12.0.02,11.05,10.015,25.019,24]hexacosa-4,16,18-trien-7-yl] benzoate |
| SMILES | CC1=NN=C2CCCCC2[C@@H]2C[C@H]3[C@@H]4CC=C5C[C@@H](OC(=O)c6ccccc6)CC[C@]5(C)[C@H]4CC[C@]3(C)[C@@H]12 |
| InChI | InChI=1S/C34H44N2O2/c1-21-31-27(25-11-7-8-12-30(25)36-35-21)20-29-26-14-13-23-19-24(38-32(37)22-9-5-4-6-10-22)15-17-33(23,2)28(26)16-18-34(29,31)3/h4-6,9-10,13,24-29,31H,7-8,11-12,14-20H2,1-3H3/t24-,25?,26+,27-,28-,29-,31-,33-,34-/m0/s1 |
| InChIKey | DGMBMVAZVACHNK-LVOBRYOPSA-N |
| XLogP | 8.04 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.74 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|