C17H11N3O6 — CID 1204403
5-[[4-(4-nitrophenoxy)phenyl]methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 1204403) has the molecular formula C17H11N3O6 and a molecular weight of 353.29 g/mol. Its IUPAC name is 5-[[4-(4-nitrophenoxy)phenyl]methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[[4-(4-nitrophenoxy)phenyl]methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 1204403 |
| Molecular Formula | C17H11N3O6 |
| Molecular Weight | 353.29 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | 5-[[4-(4-nitrophenoxy)phenyl]methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)C(=Cc2ccc(Oc3ccc([N+](=O)[O-])cc3)cc2)C(=O)N1 |
| InChI | InChI=1S/C17H11N3O6/c21-15-14(16(22)19-17(23)18-15)9-10-1-5-12(6-2-10)26-13-7-3-11(4-8-13)20(24)25/h1-9H,(H2,18,19,21,22,23) |
| InChIKey | ZZTDSCSXJXTROK-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.29 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|