C18H22ClN3O4 — CID 120509324
N-[(4-chloro-3-nitrophenyl)methyl]-2-(5-methylfuran-2-yl)-2-morpholin-4-ylethanamine (PubChem CID 120509324) has the molecular formula C18H22ClN3O4 and a molecular weight of 379.84 g/mol. Its IUPAC name is N-[(4-chloro-3-nitrophenyl)methyl]-2-(5-methylfuran-2-yl)-2-morpholin-4-ylethanamine.
| Compound Name | N-[(4-chloro-3-nitrophenyl)methyl]-2-(5-methylfuran-2-yl)-2-morpholin-4-ylethanamine |
|---|---|
| PubChem CID | 120509324 |
| Molecular Formula | C18H22ClN3O4 |
| Molecular Weight | 379.84 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | N-[(4-chloro-3-nitrophenyl)methyl]-2-(5-methylfuran-2-yl)-2-morpholin-4-ylethanamine |
| SMILES | Cc1ccc(C(CNCc2ccc(Cl)c([N+](=O)[O-])c2)N2CCOCC2)o1 |
| InChI | InChI=1S/C18H22ClN3O4/c1-13-2-5-18(26-13)17(21-6-8-25-9-7-21)12-20-11-14-3-4-15(19)16(10-14)22(23)24/h2-5,10,17,20H,6-9,11-12H2,1H3 |
| InChIKey | PMGSHGCARSUTGR-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 80.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.84 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|