C20H26N2O4 — CID 120665849
methyl 4-[[[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]amino]methyl]benzoate (PubChem CID 120665849) has the molecular formula C20H26N2O4 and a molecular weight of 358.44 g/mol. Its IUPAC name is methyl 4-[[[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]amino]methyl]benzoate.
| Compound Name | methyl 4-[[[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 120665849 |
| Molecular Formula | C20H26N2O4 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | methyl 4-[[[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]amino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CNCC(c2ccc(C)o2)N2CCOCC2)cc1 |
| InChI | InChI=1S/C20H26N2O4/c1-15-3-8-19(26-15)18(22-9-11-25-12-10-22)14-21-13-16-4-6-17(7-5-16)20(23)24-2/h3-8,18,21H,9-14H2,1-2H3 |
| InChIKey | DCXOQNJNZWOSBC-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 63.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |