C17H26N2O5S — CID 120520335
3-[3-ethoxypropyl-[2-(oxolan-2-yl)-1,3-thiazole-5-carbonyl]amino]-2-methylpropanoic acid (PubChem CID 120520335) has the molecular formula C17H26N2O5S and a molecular weight of 370.47 g/mol. Its IUPAC name is 3-[3-ethoxypropyl-[2-(oxolan-2-yl)-1,3-thiazole-5-carbonyl]amino]-2-methylpropanoic acid.
| Compound Name | 3-[3-ethoxypropyl-[2-(oxolan-2-yl)-1,3-thiazole-5-carbonyl]amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 120520335 |
| Molecular Formula | C17H26N2O5S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 3-[3-ethoxypropyl-[2-(oxolan-2-yl)-1,3-thiazole-5-carbonyl]amino]-2-methylpropanoic acid |
| SMILES | CCOCCCN(CC(C)C(=O)O)C(=O)c1cnc(C2CCCO2)s1 |
| InChI | InChI=1S/C17H26N2O5S/c1-3-23-8-5-7-19(11-12(2)17(21)22)16(20)14-10-18-15(25-14)13-6-4-9-24-13/h10,12-13H,3-9,11H2,1-2H3,(H,21,22) |
| InChIKey | MTRJKTJVJVVRDT-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|