C13H15F3N2O4 — CID 120532280
4-methoxy-3-methyl-3-[[6-(trifluoromethyl)pyridine-3-carbonyl]amino]butanoic acid (PubChem CID 120532280) has the molecular formula C13H15F3N2O4 and a molecular weight of 320.27 g/mol. Its IUPAC name is 4-methoxy-3-methyl-3-[[6-(trifluoromethyl)pyridine-3-carbonyl]amino]butanoic acid.
| Compound Name | 4-methoxy-3-methyl-3-[[6-(trifluoromethyl)pyridine-3-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 120532280 |
| Molecular Formula | C13H15F3N2O4 |
| Molecular Weight | 320.27 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 4-methoxy-3-methyl-3-[[6-(trifluoromethyl)pyridine-3-carbonyl]amino]butanoic acid |
| SMILES | COCC(C)(CC(=O)O)NC(=O)c1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C13H15F3N2O4/c1-12(7-22-2,5-10(19)20)18-11(21)8-3-4-9(17-6-8)13(14,15)16/h3-4,6H,5,7H2,1-2H3,(H,18,21)(H,19,20) |
| InChIKey | BPELEKRYJAHQGC-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.27 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |