C16H20ClNO5 — CID 120547977
2-[[2-(3-chloro-2-methylphenoxy)acetyl]amino]-2-(oxan-3-yl)acetic acid (PubChem CID 120547977) has the molecular formula C16H20ClNO5 and a molecular weight of 341.79 g/mol. Its IUPAC name is 2-[[2-(3-chloro-2-methylphenoxy)acetyl]amino]-2-(oxan-3-yl)acetic acid.
| Compound Name | 2-[[2-(3-chloro-2-methylphenoxy)acetyl]amino]-2-(oxan-3-yl)acetic acid |
|---|---|
| PubChem CID | 120547977 |
| Molecular Formula | C16H20ClNO5 |
| Molecular Weight | 341.79 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 2-[[2-(3-chloro-2-methylphenoxy)acetyl]amino]-2-(oxan-3-yl)acetic acid |
| SMILES | Cc1c(Cl)cccc1OCC(=O)NC(C(=O)O)C1CCCOC1 |
| InChI | InChI=1S/C16H20ClNO5/c1-10-12(17)5-2-6-13(10)23-9-14(19)18-15(16(20)21)11-4-3-7-22-8-11/h2,5-6,11,15H,3-4,7-9H2,1H3,(H,18,19)(H,20,21) |
| InChIKey | YLKQPSSSHGUWGY-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.79 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |