C14H10 — CID 12057628
5-(4-cyclopenta-2,4-dien-1-ylbuta-1,3-diynyl)cyclopenta-1,3-diene (PubChem CID 12057628) has the molecular formula C14H10 and a molecular weight of 178.23 g/mol. Its IUPAC name is 5-(4-cyclopenta-2,4-dien-1-ylbuta-1,3-diynyl)cyclopenta-1,3-diene.
| Compound Name | 5-(4-cyclopenta-2,4-dien-1-ylbuta-1,3-diynyl)cyclopenta-1,3-diene |
|---|---|
| PubChem CID | 12057628 |
| Molecular Formula | C14H10 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | 5-(4-cyclopenta-2,4-dien-1-ylbuta-1,3-diynyl)cyclopenta-1,3-diene |
| SMILES | C(C#CC1C=CC=C1)#CC1C=CC=C1 |
| InChI | InChI=1S/C14H10/c1-2-8-13(7-1)11-5-6-12-14-9-3-4-10-14/h1-4,7-10,13-14H |
| InChIKey | RLFQADJURHWXPT-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|