C15H19F3N2O3S — CID 120584000
2-[3-(trifluoromethoxy)phenyl]sulfonyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-amine (PubChem CID 120584000) has the molecular formula C15H19F3N2O3S and a molecular weight of 364.39 g/mol. Its IUPAC name is 2-[3-(trifluoromethoxy)phenyl]sulfonyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-amine.
| Compound Name | 2-[3-(trifluoromethoxy)phenyl]sulfonyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-amine |
|---|---|
| PubChem CID | 120584000 |
| Molecular Formula | C15H19F3N2O3S |
| Molecular Weight | 364.39 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 2-[3-(trifluoromethoxy)phenyl]sulfonyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-amine |
| SMILES | NC1CCCC2CN(S(=O)(=O)c3cccc(OC(F)(F)F)c3)CC12 |
| InChI | InChI=1S/C15H19F3N2O3S/c16-15(17,18)23-11-4-2-5-12(7-11)24(21,22)20-8-10-3-1-6-14(19)13(10)9-20/h2,4-5,7,10,13-14H,1,3,6,8-9,19H2 |
| InChIKey | IZVKOSWYLKIZOB-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.39 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |