C14H25N3O4S3 — CID 120586008
5-[2-(ethylsulfonylamino)ethyl]-N-(2-methylpiperidin-4-yl)thiophene-2-sulfonamide (PubChem CID 120586008) has the molecular formula C14H25N3O4S3 and a molecular weight of 395.57 g/mol. Its IUPAC name is 5-[2-(ethylsulfonylamino)ethyl]-N-(2-methylpiperidin-4-yl)thiophene-2-sulfonamide.
| Compound Name | 5-[2-(ethylsulfonylamino)ethyl]-N-(2-methylpiperidin-4-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 120586008 |
| Molecular Formula | C14H25N3O4S3 |
| Molecular Weight | 395.57 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | 5-[2-(ethylsulfonylamino)ethyl]-N-(2-methylpiperidin-4-yl)thiophene-2-sulfonamide |
| SMILES | CCS(=O)(=O)NCCc1ccc(S(=O)(=O)NC2CCNC(C)C2)s1 |
| InChI | InChI=1S/C14H25N3O4S3/c1-3-23(18,19)16-9-7-13-4-5-14(22-13)24(20,21)17-12-6-8-15-11(2)10-12/h4-5,11-12,15-17H,3,6-10H2,1-2H3 |
| InChIKey | GIEWNQJMBZIBRF-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.57 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |