C16H20N4O2S — CID 120591213
4-amino-3-methoxy-N-(2-methyl-4-pyrimidin-2-ylsulfanylphenyl)butanamide (PubChem CID 120591213) has the molecular formula C16H20N4O2S and a molecular weight of 332.43 g/mol. Its IUPAC name is 4-amino-3-methoxy-N-(2-methyl-4-pyrimidin-2-ylsulfanylphenyl)butanamide.
| Compound Name | 4-amino-3-methoxy-N-(2-methyl-4-pyrimidin-2-ylsulfanylphenyl)butanamide |
|---|---|
| PubChem CID | 120591213 |
| Molecular Formula | C16H20N4O2S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 4-amino-3-methoxy-N-(2-methyl-4-pyrimidin-2-ylsulfanylphenyl)butanamide |
| SMILES | COC(CN)CC(=O)Nc1ccc(Sc2ncccn2)cc1C |
| InChI | InChI=1S/C16H20N4O2S/c1-11-8-13(23-16-18-6-3-7-19-16)4-5-14(11)20-15(21)9-12(10-17)22-2/h3-8,12H,9-10,17H2,1-2H3,(H,20,21) |
| InChIKey | ULJUFZBOBKPAPE-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |