C20H19ClN4OS — CID 56554553
1-[1-(4-chlorophenyl)ethyl]-3-(2-methyl-4-pyrimidin-2-ylsulfanylphenyl)urea (PubChem CID 56554553) has the molecular formula C20H19ClN4OS and a molecular weight of 398.92 g/mol. Its IUPAC name is 1-[1-(4-chlorophenyl)ethyl]-3-(2-methyl-4-pyrimidin-2-ylsulfanylphenyl)urea.
| Compound Name | 1-[1-(4-chlorophenyl)ethyl]-3-(2-methyl-4-pyrimidin-2-ylsulfanylphenyl)urea |
|---|---|
| PubChem CID | 56554553 |
| Molecular Formula | C20H19ClN4OS |
| Molecular Weight | 398.92 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 1-[1-(4-chlorophenyl)ethyl]-3-(2-methyl-4-pyrimidin-2-ylsulfanylphenyl)urea |
| SMILES | Cc1cc(Sc2ncccn2)ccc1NC(=O)NC(C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H19ClN4OS/c1-13-12-17(27-20-22-10-3-11-23-20)8-9-18(13)25-19(26)24-14(2)15-4-6-16(21)7-5-15/h3-12,14H,1-2H3,(H2,24,25,26) |
| InChIKey | PBCKUNQGOKBNND-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.92 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |