C20H30N4O2 — CID 120602193
1-N-(3-methylphenyl)-3-N-(2-methylpiperidin-4-yl)piperidine-1,3-dicarboxamide (PubChem CID 120602193) has the molecular formula C20H30N4O2 and a molecular weight of 358.49 g/mol. Its IUPAC name is 1-N-(3-methylphenyl)-3-N-(2-methylpiperidin-4-yl)piperidine-1,3-dicarboxamide.
| Compound Name | 1-N-(3-methylphenyl)-3-N-(2-methylpiperidin-4-yl)piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 120602193 |
| Molecular Formula | C20H30N4O2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | 1-N-(3-methylphenyl)-3-N-(2-methylpiperidin-4-yl)piperidine-1,3-dicarboxamide |
| SMILES | Cc1cccc(NC(=O)N2CCCC(C(=O)NC3CCNC(C)C3)C2)c1 |
| InChI | InChI=1S/C20H30N4O2/c1-14-5-3-7-17(11-14)23-20(26)24-10-4-6-16(13-24)19(25)22-18-8-9-21-15(2)12-18/h3,5,7,11,15-16,18,21H,4,6,8-10,12-13H2,1-2H3,(H,22,25)(H,23,26) |
| InChIKey | MUEWOIDDIIIRHT-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |