C13H21IN4O — CID 120602893
1-cyclopropyl-3-[(1,6-dimethyl-2-oxo-3-pyridinyl)methyl]-2-methylguanidine;hydroiodide (PubChem CID 120602893) has the molecular formula C13H21IN4O and a molecular weight of 376.24 g/mol. Its IUPAC name is 1-cyclopropyl-3-[(1,6-dimethyl-2-oxo-3-pyridinyl)methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-cyclopropyl-3-[(1,6-dimethyl-2-oxo-3-pyridinyl)methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 120602893 |
| Molecular Formula | C13H21IN4O |
| Molecular Weight | 376.24 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 1-cyclopropyl-3-[(1,6-dimethyl-2-oxo-3-pyridinyl)methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(C)n(C)c1=O)NC1CC1.I |
| InChI | InChI=1S/C13H20N4O.HI/c1-9-4-5-10(12(18)17(9)3)8-15-13(14-2)16-11-6-7-11;/h4-5,11H,6-8H2,1-3H3,(H2,14,15,16);1H |
| InChIKey | SYJUUFXOJPJPPD-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 58.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.24 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|