C17H23ClN4O4S — CID 120611507
3-(2-aminophenyl)-1-[4-(1,2-oxazol-3-ylmethylsulfonyl)piperazin-1-yl]propan-1-one;hydrochloride (PubChem CID 120611507) has the molecular formula C17H23ClN4O4S and a molecular weight of 414.92 g/mol. Its IUPAC name is 3-(2-aminophenyl)-1-[4-(1,2-oxazol-3-ylmethylsulfonyl)piperazin-1-yl]propan-1-one;hydrochloride.
| Compound Name | 3-(2-aminophenyl)-1-[4-(1,2-oxazol-3-ylmethylsulfonyl)piperazin-1-yl]propan-1-one;hydrochloride |
|---|---|
| PubChem CID | 120611507 |
| Molecular Formula | C17H23ClN4O4S |
| Molecular Weight | 414.92 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | 3-(2-aminophenyl)-1-[4-(1,2-oxazol-3-ylmethylsulfonyl)piperazin-1-yl]propan-1-one;hydrochloride |
| SMILES | Cl.Nc1ccccc1CCC(=O)N1CCN(S(=O)(=O)Cc2ccon2)CC1 |
| InChI | InChI=1S/C17H22N4O4S.ClH/c18-16-4-2-1-3-14(16)5-6-17(22)20-8-10-21(11-9-20)26(23,24)13-15-7-12-25-19-15;/h1-4,7,12H,5-6,8-11,13,18H2;1H |
| InChIKey | CZXXQCDAAMZYKN-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 109.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.92 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|