C14H22N4O4S2 — CID 120616919
ethyl 2-[[5-[[4-(methoxymethyl)piperidine-4-carbonyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate (PubChem CID 120616919) has the molecular formula C14H22N4O4S2 and a molecular weight of 374.49 g/mol. Its IUPAC name is ethyl 2-[[5-[[4-(methoxymethyl)piperidine-4-carbonyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate.
| Compound Name | ethyl 2-[[5-[[4-(methoxymethyl)piperidine-4-carbonyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 120616919 |
| Molecular Formula | C14H22N4O4S2 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | ethyl 2-[[5-[[4-(methoxymethyl)piperidine-4-carbonyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
| SMILES | CCOC(=O)CSc1nnc(NC(=O)C2(COC)CCNCC2)s1 |
| InChI | InChI=1S/C14H22N4O4S2/c1-3-22-10(19)8-23-13-18-17-12(24-13)16-11(20)14(9-21-2)4-6-15-7-5-14/h15H,3-9H2,1-2H3,(H,16,17,20) |
| InChIKey | DICDSNRNNNHGGE-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|