C29H37NO4 — CID 12062747
butyl 4-(3,3,6,6,9-pentamethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl)benzoate (PubChem CID 12062747) has the molecular formula C29H37NO4 and a molecular weight of 463.62 g/mol. Its IUPAC name is butyl 4-(3,3,6,6,9-pentamethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl)benzoate.
| Compound Name | butyl 4-(3,3,6,6,9-pentamethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl)benzoate |
|---|---|
| PubChem CID | 12062747 |
| Molecular Formula | C29H37NO4 |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.27 |
| IUPAC Name | butyl 4-(3,3,6,6,9-pentamethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl)benzoate |
| SMILES | CCCCOC(=O)c1ccc(N2C3=C(C(=O)CC(C)(C)C3)C(C)C3=C2CC(C)(C)CC3=O)cc1 |
| InChI | InChI=1S/C29H37NO4/c1-7-8-13-34-27(33)19-9-11-20(12-10-19)30-21-14-28(3,4)16-23(31)25(21)18(2)26-22(30)15-29(5,6)17-24(26)32/h9-12,18H,7-8,13-17H2,1-6H3 |
| InChIKey | BXLBYBZNFMUSNK-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|