C19H21Cl2NO4 — CID 120628468
(3aS,7aS)-2-[1-(3,4-dichlorophenyl)cyclobutanecarbonyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid (PubChem CID 120628468) has the molecular formula C19H21Cl2NO4 and a molecular weight of 398.29 g/mol. Its IUPAC name is (3aS,7aS)-2-[1-(3,4-dichlorophenyl)cyclobutanecarbonyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid.
| Compound Name | (3aS,7aS)-2-[1-(3,4-dichlorophenyl)cyclobutanecarbonyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid |
|---|---|
| PubChem CID | 120628468 |
| Molecular Formula | C19H21Cl2NO4 |
| Molecular Weight | 398.29 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | (3aS,7aS)-2-[1-(3,4-dichlorophenyl)cyclobutanecarbonyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid |
| SMILES | O=C(N1C[C@H]2COCC[C@@]2(C(=O)O)C1)C1(c2ccc(Cl)c(Cl)c2)CCC1 |
| InChI | InChI=1S/C19H21Cl2NO4/c20-14-3-2-12(8-15(14)21)18(4-1-5-18)16(23)22-9-13-10-26-7-6-19(13,11-22)17(24)25/h2-3,8,13H,1,4-7,9-11H2,(H,24,25)/t13-,19+/m0/s1 |
| InChIKey | IZIGFJOZMYUOCU-ORAYPTAESA-N |
| XLogP | 3.36 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.29 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |