C10H20CrOSi — CID 12063120
[(E)-3-[tert-butyl(dimethyl)silyl]-1-methoxyprop-2-enylidene]chromium (PubChem CID 12063120) has the molecular formula C10H20CrOSi and a molecular weight of 236.35 g/mol. Its IUPAC name is [(E)-3-[tert-butyl(dimethyl)silyl]-1-methoxyprop-2-enylidene]chromium.
| Compound Name | [(E)-3-[tert-butyl(dimethyl)silyl]-1-methoxyprop-2-enylidene]chromium |
|---|---|
| PubChem CID | 12063120 |
| Molecular Formula | C10H20CrOSi |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | [(E)-3-[tert-butyl(dimethyl)silyl]-1-methoxyprop-2-enylidene]chromium |
| SMILES | COC(=[Cr])/C=C/[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C10H20OSi.Cr/c1-10(2,3)12(5,6)9-7-8-11-4;/h7,9H,1-6H3;/b9-7+; |
| InChIKey | XEYOLHGPSPWQNY-BXTVWIJMSA-N |
| XLogP | 2.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|