C15H34Si2 — CID 12977713
tert-butyl-[(E)-3-[tert-butyl(dimethyl)silyl]prop-1-enyl]-dimethylsilane (PubChem CID 12977713) has the molecular formula C15H34Si2 and a molecular weight of 270.61 g/mol. Its IUPAC name is tert-butyl-[(E)-3-[tert-butyl(dimethyl)silyl]prop-1-enyl]-dimethylsilane.
| Compound Name | tert-butyl-[(E)-3-[tert-butyl(dimethyl)silyl]prop-1-enyl]-dimethylsilane |
|---|---|
| PubChem CID | 12977713 |
| Molecular Formula | C15H34Si2 |
| Molecular Weight | 270.61 g/mol |
| Exact Mass | 270.22 |
| IUPAC Name | tert-butyl-[(E)-3-[tert-butyl(dimethyl)silyl]prop-1-enyl]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)/C=C/C[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H34Si2/c1-14(2,3)16(7,8)12-11-13-17(9,10)15(4,5)6/h11-12H,13H2,1-10H3/b12-11+ |
| InChIKey | SSUQULQUWRHVMP-VAWYXSNFSA-N |
| XLogP | 6.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.61 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|