C14H22F2Si — CID 151241725
tert-butyl-(7,7-difluoro-6-methylhepta-2,6-dien-4-ynyl)-dimethylsilane (PubChem CID 151241725) has the molecular formula C14H22F2Si and a molecular weight of 256.41 g/mol. Its IUPAC name is tert-butyl-(7,7-difluoro-6-methylhepta-2,6-dien-4-ynyl)-dimethylsilane.
| Compound Name | tert-butyl-(7,7-difluoro-6-methylhepta-2,6-dien-4-ynyl)-dimethylsilane |
|---|---|
| PubChem CID | 151241725 |
| Molecular Formula | C14H22F2Si |
| Molecular Weight | 256.41 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | tert-butyl-(7,7-difluoro-6-methylhepta-2,6-dien-4-ynyl)-dimethylsilane |
| SMILES | CC(C#CC=CC[Si](C)(C)C(C)(C)C)=C(F)F |
| InChI | InChI=1S/C14H22F2Si/c1-12(13(15)16)10-8-7-9-11-17(5,6)14(2,3)4/h7,9H,11H2,1-6H3 |
| InChIKey | NQLNXYZITZVLSD-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.41 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|