C24H42NO2Si+ — CID 134973757
[4-[(E)-11-[tert-butyl(dimethyl)silyl]undec-9-enoxy]carbonylphenyl]azanium (PubChem CID 134973757) has the molecular formula C24H42NO2Si+ and a molecular weight of 404.69 g/mol. Its IUPAC name is [4-[(E)-11-[tert-butyl(dimethyl)silyl]undec-9-enoxy]carbonylphenyl]azanium.
| Compound Name | [4-[(E)-11-[tert-butyl(dimethyl)silyl]undec-9-enoxy]carbonylphenyl]azanium |
|---|---|
| PubChem CID | 134973757 |
| Molecular Formula | C24H42NO2Si+ |
| Molecular Weight | 404.69 g/mol |
| Exact Mass | 404.30 |
| IUPAC Name | [4-[(E)-11-[tert-butyl(dimethyl)silyl]undec-9-enoxy]carbonylphenyl]azanium |
| SMILES | CC(C)(C)[Si](C)(C)C/C=C/CCCCCCCCOC(=O)c1ccc([NH3+])cc1 |
| InChI | InChI=1S/C24H41NO2Si/c1-24(2,3)28(4,5)20-14-12-10-8-6-7-9-11-13-19-27-23(26)21-15-17-22(25)18-16-21/h12,14-18H,6-11,13,19-20,25H2,1-5H3/p+1/b14-12+ |
| InChIKey | OJGKBEZCKIBTGV-WYMLVPIESA-O |
| XLogP | 6.51 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.69 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|