C11H19O4P — CID 12063531
diethyl (5-methylcyclohexa-1,5-dien-1-yl) phosphate (PubChem CID 12063531) has the molecular formula C11H19O4P and a molecular weight of 246.24 g/mol. Its IUPAC name is diethyl (5-methylcyclohexa-1,5-dien-1-yl) phosphate.
| Compound Name | diethyl (5-methylcyclohexa-1,5-dien-1-yl) phosphate |
|---|---|
| PubChem CID | 12063531 |
| Molecular Formula | C11H19O4P |
| Molecular Weight | 246.24 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | diethyl (5-methylcyclohexa-1,5-dien-1-yl) phosphate |
| SMILES | CCOP(=O)(OCC)OC1=CCCC(C)=C1 |
| InChI | InChI=1S/C11H19O4P/c1-4-13-16(12,14-5-2)15-11-8-6-7-10(3)9-11/h8-9H,4-7H2,1-3H3 |
| InChIKey | DECQOHSLETVSEZ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.24 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|