C13H23O4P — CID 12063539
diethyl (3,3,5-trimethylcyclohexa-1,5-dien-1-yl) phosphate (PubChem CID 12063539) has the molecular formula C13H23O4P and a molecular weight of 274.30 g/mol. Its IUPAC name is diethyl (3,3,5-trimethylcyclohexa-1,5-dien-1-yl) phosphate.
| Compound Name | diethyl (3,3,5-trimethylcyclohexa-1,5-dien-1-yl) phosphate |
|---|---|
| PubChem CID | 12063539 |
| Molecular Formula | C13H23O4P |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | diethyl (3,3,5-trimethylcyclohexa-1,5-dien-1-yl) phosphate |
| SMILES | CCOP(=O)(OCC)OC1=CC(C)(C)CC(C)=C1 |
| InChI | InChI=1S/C13H23O4P/c1-6-15-18(14,16-7-2)17-12-8-11(3)9-13(4,5)10-12/h8,10H,6-7,9H2,1-5H3 |
| InChIKey | OGHQEDDOUYTUDE-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|