C19H20ClN3O2S2 — CID 120639154
[4-(5-amino-2-methylbenzoyl)piperazin-1-yl]-thieno[3,2-b]thiophen-5-ylmethanone;hydrochloride (PubChem CID 120639154) has the molecular formula C19H20ClN3O2S2 and a molecular weight of 421.98 g/mol. Its IUPAC name is [4-(5-amino-2-methylbenzoyl)piperazin-1-yl]-thieno[3,2-b]thiophen-5-ylmethanone;hydrochloride.
| Compound Name | [4-(5-amino-2-methylbenzoyl)piperazin-1-yl]-thieno[3,2-b]thiophen-5-ylmethanone;hydrochloride |
|---|---|
| PubChem CID | 120639154 |
| Molecular Formula | C19H20ClN3O2S2 |
| Molecular Weight | 421.98 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | [4-(5-amino-2-methylbenzoyl)piperazin-1-yl]-thieno[3,2-b]thiophen-5-ylmethanone;hydrochloride |
| SMILES | Cc1ccc(N)cc1C(=O)N1CCN(C(=O)c2cc3sccc3s2)CC1.Cl |
| InChI | InChI=1S/C19H19N3O2S2.ClH/c1-12-2-3-13(20)10-14(12)18(23)21-5-7-22(8-6-21)19(24)17-11-16-15(26-17)4-9-25-16;/h2-4,9-11H,5-8,20H2,1H3;1H |
| InChIKey | UZTFITKRNBKEGD-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.98 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|