C15H20N2O3S2 — CID 122150795
[4-(2,2-dimethoxyethyl)piperazin-1-yl]-thieno[3,2-b]thiophen-5-ylmethanone (PubChem CID 122150795) has the molecular formula C15H20N2O3S2 and a molecular weight of 340.47 g/mol. Its IUPAC name is [4-(2,2-dimethoxyethyl)piperazin-1-yl]-thieno[3,2-b]thiophen-5-ylmethanone.
| Compound Name | [4-(2,2-dimethoxyethyl)piperazin-1-yl]-thieno[3,2-b]thiophen-5-ylmethanone |
|---|---|
| PubChem CID | 122150795 |
| Molecular Formula | C15H20N2O3S2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | [4-(2,2-dimethoxyethyl)piperazin-1-yl]-thieno[3,2-b]thiophen-5-ylmethanone |
| SMILES | COC(CN1CCN(C(=O)c2cc3sccc3s2)CC1)OC |
| InChI | InChI=1S/C15H20N2O3S2/c1-19-14(20-2)10-16-4-6-17(7-5-16)15(18)13-9-12-11(22-13)3-8-21-12/h3,8-9,14H,4-7,10H2,1-2H3 |
| InChIKey | YYHBSVBFRURERQ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|