C12H20ClN5O3 — CID 120639471
(2S,4S)-2-methyl-N-[2-(4-nitropyrazol-1-yl)ethyl]piperidine-4-carboxamide;hydrochloride (PubChem CID 120639471) has the molecular formula C12H20ClN5O3 and a molecular weight of 317.78 g/mol. Its IUPAC name is (2S,4S)-2-methyl-N-[2-(4-nitropyrazol-1-yl)ethyl]piperidine-4-carboxamide;hydrochloride.
| Compound Name | (2S,4S)-2-methyl-N-[2-(4-nitropyrazol-1-yl)ethyl]piperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120639471 |
| Molecular Formula | C12H20ClN5O3 |
| Molecular Weight | 317.78 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | (2S,4S)-2-methyl-N-[2-(4-nitropyrazol-1-yl)ethyl]piperidine-4-carboxamide;hydrochloride |
| SMILES | C[C@H]1C[C@@H](C(=O)NCCn2cc([N+](=O)[O-])cn2)CCN1.Cl |
| InChI | InChI=1S/C12H19N5O3.ClH/c1-9-6-10(2-3-13-9)12(18)14-4-5-16-8-11(7-15-16)17(19)20;/h7-10,13H,2-6H2,1H3,(H,14,18);1H/t9-,10-;/m0./s1 |
| InChIKey | ITNJBVJPFNNZFD-IYPAPVHQSA-N |
| XLogP | 0.72 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.78 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|