C16H18ClF3N6O3 — CID 120642671
N-(2-methyl-5-piperidin-4-yl-1,2,4-triazol-3-yl)-3-nitro-5-(trifluoromethyl)benzamide;hydrochloride (PubChem CID 120642671) has the molecular formula C16H18ClF3N6O3 and a molecular weight of 434.81 g/mol. Its IUPAC name is N-(2-methyl-5-piperidin-4-yl-1,2,4-triazol-3-yl)-3-nitro-5-(trifluoromethyl)benzamide;hydrochloride.
| Compound Name | N-(2-methyl-5-piperidin-4-yl-1,2,4-triazol-3-yl)-3-nitro-5-(trifluoromethyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 120642671 |
| Molecular Formula | C16H18ClF3N6O3 |
| Molecular Weight | 434.81 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | N-(2-methyl-5-piperidin-4-yl-1,2,4-triazol-3-yl)-3-nitro-5-(trifluoromethyl)benzamide;hydrochloride |
| SMILES | Cl.Cn1nc(C2CCNCC2)nc1NC(=O)c1cc([N+](=O)[O-])cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H17F3N6O3.ClH/c1-24-15(21-13(23-24)9-2-4-20-5-3-9)22-14(26)10-6-11(16(17,18)19)8-12(7-10)25(27)28;/h6-9,20H,2-5H2,1H3,(H,21,22,23,26);1H |
| InChIKey | UGBWSSAAFKYHQA-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 114.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.81 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|