C13H17ClN6O3S — CID 120644378
N-(2-methyl-5-piperidin-4-yl-1,2,4-triazol-3-yl)-5-nitrothiophene-2-carboxamide;hydrochloride (PubChem CID 120644378) has the molecular formula C13H17ClN6O3S and a molecular weight of 372.84 g/mol. Its IUPAC name is N-(2-methyl-5-piperidin-4-yl-1,2,4-triazol-3-yl)-5-nitrothiophene-2-carboxamide;hydrochloride.
| Compound Name | N-(2-methyl-5-piperidin-4-yl-1,2,4-triazol-3-yl)-5-nitrothiophene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120644378 |
| Molecular Formula | C13H17ClN6O3S |
| Molecular Weight | 372.84 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | N-(2-methyl-5-piperidin-4-yl-1,2,4-triazol-3-yl)-5-nitrothiophene-2-carboxamide;hydrochloride |
| SMILES | Cl.Cn1nc(C2CCNCC2)nc1NC(=O)c1ccc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C13H16N6O3S.ClH/c1-18-13(15-11(17-18)8-4-6-14-7-5-8)16-12(20)9-2-3-10(23-9)19(21)22;/h2-3,8,14H,4-7H2,1H3,(H,15,16,17,20);1H |
| InChIKey | APKFYSUTWBLTMW-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 114.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.84 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|