C16H20N6O3 — CID 120643837
4-methyl-N-(2-methyl-5-piperidin-4-yl-1,2,4-triazol-3-yl)-3-nitrobenzamide (PubChem CID 120643837) has the molecular formula C16H20N6O3 and a molecular weight of 344.38 g/mol. Its IUPAC name is 4-methyl-N-(2-methyl-5-piperidin-4-yl-1,2,4-triazol-3-yl)-3-nitrobenzamide.
| Compound Name | 4-methyl-N-(2-methyl-5-piperidin-4-yl-1,2,4-triazol-3-yl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 120643837 |
| Molecular Formula | C16H20N6O3 |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 4-methyl-N-(2-methyl-5-piperidin-4-yl-1,2,4-triazol-3-yl)-3-nitrobenzamide |
| SMILES | Cc1ccc(C(=O)Nc2nc(C3CCNCC3)nn2C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H20N6O3/c1-10-3-4-12(9-13(10)22(24)25)15(23)19-16-18-14(20-21(16)2)11-5-7-17-8-6-11/h3-4,9,11,17H,5-8H2,1-2H3,(H,18,19,20,23) |
| InChIKey | AWLNEHOZNYAWBH-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 114.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|