C16H20N6O3S — CID 120643432
N-(2-methyl-5-piperidin-4-yl-1,2,4-triazol-3-yl)-4-methylsulfanyl-3-nitrobenzamide (PubChem CID 120643432) has the molecular formula C16H20N6O3S and a molecular weight of 376.44 g/mol. Its IUPAC name is N-(2-methyl-5-piperidin-4-yl-1,2,4-triazol-3-yl)-4-methylsulfanyl-3-nitrobenzamide.
| Compound Name | N-(2-methyl-5-piperidin-4-yl-1,2,4-triazol-3-yl)-4-methylsulfanyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 120643432 |
| Molecular Formula | C16H20N6O3S |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | N-(2-methyl-5-piperidin-4-yl-1,2,4-triazol-3-yl)-4-methylsulfanyl-3-nitrobenzamide |
| SMILES | CSc1ccc(C(=O)Nc2nc(C3CCNCC3)nn2C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H20N6O3S/c1-21-16(18-14(20-21)10-5-7-17-8-6-10)19-15(23)11-3-4-13(26-2)12(9-11)22(24)25/h3-4,9-10,17H,5-8H2,1-2H3,(H,18,19,20,23) |
| InChIKey | FUWVOEDVPZGXTO-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 114.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|