C9H20ClN3O2S — CID 120665253
(3aS,6aR)-N-ethyl-N-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-sulfonamide;hydrochloride (PubChem CID 120665253) has the molecular formula C9H20ClN3O2S and a molecular weight of 269.80 g/mol. Its IUPAC name is (3aS,6aR)-N-ethyl-N-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-sulfonamide;hydrochloride.
| Compound Name | (3aS,6aR)-N-ethyl-N-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120665253 |
| Molecular Formula | C9H20ClN3O2S |
| Molecular Weight | 269.80 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | (3aS,6aR)-N-ethyl-N-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-sulfonamide;hydrochloride |
| SMILES | CCN(C)S(=O)(=O)N1C[C@H]2CNC[C@H]2C1.Cl |
| InChI | InChI=1S/C9H19N3O2S.ClH/c1-3-11(2)15(13,14)12-6-8-4-10-5-9(8)7-12;/h8-10H,3-7H2,1-2H3;1H/t8-,9+; |
| InChIKey | AQCONBSBORHYKN-UFIFRZAQSA-N |
| XLogP | -0.24 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.80 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |