C27H45F6N5O8 — CID 12066942
tert-butyl N,N-bis[2-[(2-methylpropan-2-yl)oxycarbonyl-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]amino]ethyl]carbamate (PubChem CID 12066942) has the molecular formula C27H45F6N5O8 and a molecular weight of 681.67 g/mol. Its IUPAC name is tert-butyl N,N-bis[2-[(2-methylpropan-2-yl)oxycarbonyl-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N,N-bis[2-[(2-methylpropan-2-yl)oxycarbonyl-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 12066942 |
| Molecular Formula | C27H45F6N5O8 |
| Molecular Weight | 681.67 g/mol |
| Exact Mass | 681.32 |
| IUPAC Name | tert-butyl N,N-bis[2-[(2-methylpropan-2-yl)oxycarbonyl-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCNC(=O)C(F)(F)F)CCN(CCN(CCNC(=O)C(F)(F)F)C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H45F6N5O8/c1-23(2,3)44-20(41)36(12-10-34-18(39)26(28,29)30)14-16-38(22(43)46-25(7,8)9)17-15-37(21(42)45-24(4,5)6)13-11-35-19(40)27(31,32)33/h10-17H2,1-9H3,(H,34,39)(H,35,40) |
| InChIKey | OWYRKMAIWHTSFC-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 146.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.67 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|