C17H18N4O5 — CID 120677078
cis-(1S,3R)-3-[[1-methyl-3-(4-nitrophenyl)pyrazole-4-carbonyl]amino]cyclopentane-1-carboxylic acid (PubChem CID 120677078) has the molecular formula C17H18N4O5 and a molecular weight of 358.35 g/mol. Its IUPAC name is cis-(1S,3R)-3-[[1-methyl-3-(4-nitrophenyl)pyrazole-4-carbonyl]amino]cyclopentane-1-carboxylic acid.
| Compound Name | cis-(1S,3R)-3-[[1-methyl-3-(4-nitrophenyl)pyrazole-4-carbonyl]amino]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 120677078 |
| Molecular Formula | C17H18N4O5 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | cis-(1S,3R)-3-[[1-methyl-3-(4-nitrophenyl)pyrazole-4-carbonyl]amino]cyclopentane-1-carboxylic acid |
| SMILES | Cn1cc(C(=O)N[C@@H]2CC[C@H](C(=O)O)C2)c(-c2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C17H18N4O5/c1-20-9-14(16(22)18-12-5-2-11(8-12)17(23)24)15(19-20)10-3-6-13(7-4-10)21(25)26/h3-4,6-7,9,11-12H,2,5,8H2,1H3,(H,18,22)(H,23,24)/t11-,12+/m0/s1 |
| InChIKey | LWEIGEQYHWYTBF-NWDGAFQWSA-N |
| XLogP | 1.98 |
| TPSA | 127.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|