C23H27N7O3 — CID 86968975
1-methyl-3-(4-nitrophenyl)-N-[1-(4-pyridin-2-ylpiperazin-1-yl)propan-2-yl]pyrazole-4-carboxamide (PubChem CID 86968975) has the molecular formula C23H27N7O3 and a molecular weight of 449.52 g/mol. Its IUPAC name is 1-methyl-3-(4-nitrophenyl)-N-[1-(4-pyridin-2-ylpiperazin-1-yl)propan-2-yl]pyrazole-4-carboxamide.
| Compound Name | 1-methyl-3-(4-nitrophenyl)-N-[1-(4-pyridin-2-ylpiperazin-1-yl)propan-2-yl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 86968975 |
| Molecular Formula | C23H27N7O3 |
| Molecular Weight | 449.52 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | 1-methyl-3-(4-nitrophenyl)-N-[1-(4-pyridin-2-ylpiperazin-1-yl)propan-2-yl]pyrazole-4-carboxamide |
| SMILES | CC(CN1CCN(c2ccccn2)CC1)NC(=O)c1cn(C)nc1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H27N7O3/c1-17(15-28-11-13-29(14-12-28)21-5-3-4-10-24-21)25-23(31)20-16-27(2)26-22(20)18-6-8-19(9-7-18)30(32)33/h3-10,16-17H,11-15H2,1-2H3,(H,25,31) |
| InChIKey | MKGJZEYIGWRABQ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 109.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.52 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|