C19H24Cl2N2O3 — CID 120680624
(3aS,6aR)-2-[1-(2-chlorophenyl)-2-oxopiperidin-3-yl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid;hydrochloride (PubChem CID 120680624) has the molecular formula C19H24Cl2N2O3 and a molecular weight of 399.32 g/mol. Its IUPAC name is (3aS,6aR)-2-[1-(2-chlorophenyl)-2-oxopiperidin-3-yl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid;hydrochloride.
| Compound Name | (3aS,6aR)-2-[1-(2-chlorophenyl)-2-oxopiperidin-3-yl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 120680624 |
| Molecular Formula | C19H24Cl2N2O3 |
| Molecular Weight | 399.32 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | (3aS,6aR)-2-[1-(2-chlorophenyl)-2-oxopiperidin-3-yl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid;hydrochloride |
| SMILES | Cl.O=C1C(N2C[C@@H]3CCC[C@@]3(C(=O)O)C2)CCCN1c1ccccc1Cl |
| InChI | InChI=1S/C19H23ClN2O3.ClH/c20-14-6-1-2-7-15(14)22-10-4-8-16(17(22)23)21-11-13-5-3-9-19(13,12-21)18(24)25;/h1-2,6-7,13,16H,3-5,8-12H2,(H,24,25);1H/t13-,16?,19+;/m0./s1 |
| InChIKey | REJBUKVFCZCIMS-RKFRHRHXSA-N |
| XLogP | 3.44 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.32 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |