C17H25NO5 — CID 120688752
3-[[2-(2,5-dimethoxyphenyl)acetyl]amino]-3-ethylpentanoic acid (PubChem CID 120688752) has the molecular formula C17H25NO5 and a molecular weight of 323.39 g/mol. Its IUPAC name is 3-[[2-(2,5-dimethoxyphenyl)acetyl]amino]-3-ethylpentanoic acid.
| Compound Name | 3-[[2-(2,5-dimethoxyphenyl)acetyl]amino]-3-ethylpentanoic acid |
|---|---|
| PubChem CID | 120688752 |
| Molecular Formula | C17H25NO5 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 3-[[2-(2,5-dimethoxyphenyl)acetyl]amino]-3-ethylpentanoic acid |
| SMILES | CCC(CC)(CC(=O)O)NC(=O)Cc1cc(OC)ccc1OC |
| InChI | InChI=1S/C17H25NO5/c1-5-17(6-2,11-16(20)21)18-15(19)10-12-9-13(22-3)7-8-14(12)23-4/h7-9H,5-6,10-11H2,1-4H3,(H,18,19)(H,20,21) |
| InChIKey | PYSZIQPFGCDTBA-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |